| Product Name | 4-Ethoxycinnamic acid |
| CAS No. | 2373-79-7 |
| Synonyms | 4-Ethoxycinnamic acid,predominantly trans; (2E)-3-(4-ethoxyphenyl)prop-2-enoic acid; (2Z)-3-(4-ethoxyphenyl)prop-2-enoic acid; (2E)-3-(4-ethoxyphenyl)prop-2-enoate; 3-(4-ETHOXYPHENYL) PROPENOIC ACID |
| InChI | InChI=1/C11H12O3/c1-2-14-10-6-3-9(4-7-10)5-8-11(12)13/h3-8H,2H2,1H3,(H,12,13)/p-1/b8-5+ |
| Molecular Formula | C11H11O3 |
| Molecular Weight | 191.2038 |
| Melting point | 195-199℃ |
| Boiling point | 353.2°C at 760 mmHg |
| Flash point | 139.2°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2373-79-7 4-ethoxycinnamic acid
service@apichina.com