| Product Name | 4-Ethoxybenzonitrile |
| CAS No. | 25117-74-2 |
| Synonyms | 4-Ethoxybenzoic acid nitrile; p-Ethoxybenzonitrile |
| InChI | InChI=1/C9H9NO/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6H,2H2,1H3 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.1739 |
| Density | 1.05g/cm3 |
| Boiling point | 258°C at 760 mmHg |
| Flash point | 110.9°C |
| Refractive index | 1.52 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
25117-74-2 4-ethoxybenzonitrile
service@apichina.com