| Product Name | 4-Ethoxy-3-nitropyridine hydrochloride |
| CAS No. | 94602-04-7 |
| Synonyms | 3-Nitro-4-ethoxypyridine hydrochloride; 4-ethoxy-3-nitropyridine hydrochloride (1:1) |
| InChI | InChI=1/C7H8N2O3.ClH/c1-2-12-7-3-4-8-5-6(7)9(10)11;/h3-5H,2H2,1H3;1H |
| Molecular Formula | C7H9ClN2O3 |
| Molecular Weight | 204.611 |
| Boiling point | 319.2°C at 760 mmHg |
| Flash point | 146.8°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
94602-04-7 4-ethoxy-3-nitropyridine hydrochloride
service@apichina.com