| Product Name | 4-Dodecylphenol, mixture of isomers |
| CAS No. | 27193-86-8 |
| Synonyms | Dodecylphenol, mixture of isomers; 2-dodecylphenol |
| InChI | InChI=1/C18H30O/c1-2-3-4-5-6-7-8-9-10-11-14-17-15-12-13-16-18(17)19/h12-13,15-16,19H,2-11,14H2,1H3 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.4302 |
| Density | 0.918g/cm3 |
| Boiling point | 368.3°C at 760 mmHg |
| Flash point | 210.8°C |
| Refractive index | 1.499 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
27193-86-8 4-dodecylphenol, mixture of isomers
service@apichina.com