| Product Name | 4-Dipropylaminobutyronitrile |
| CAS No. | 70288-99-2 |
| Synonyms | 4-(Di-n-propylamino)butyronitrile; 4-(dipropylamino)butanenitrile |
| InChI | InChI=1/C10H20N2/c1-3-8-12(9-4-2)10-6-5-7-11/h3-6,8-10H2,1-2H3 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.2792 |
| Density | 0.866g/cm3 |
| Boiling point | 256.7°C at 760 mmHg |
| Flash point | 94.7°C |
| Refractive index | 1.448 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
70288-99-2 4-dipropylaminobutyronitrile
service@apichina.com