| Product Name | 4-dimethylaminopiperidine |
| CAS No. | 50533-97-6 |
| Synonyms | 4-(Dimethylamino)piperidine; N,N-dimethylpiperidin-4-amine |
| InChI | InChI=1/C7H16N2/c1-9(2)7-3-5-8-6-4-7/h7-8H,3-6H2,1-2H3 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.2153 |
| Density | 0.91g/cm3 |
| Boiling point | 179.7°C at 760 mmHg |
| Flash point | 63.3°C |
| Refractive index | 1.479 |
| Risk Codes | R10:Flammable.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
50533-97-6 4-dimethylaminopiperidine
service@apichina.com