| Product Name | 4-Dimethylaminophenyl isothiocyanate |
| CAS No. | 2131-64-8 |
| Synonyms | Isothiocyanic acid, p-dimethylaminophenyl ester; 4-(Dimethylamino)phenyl isothiocyanate; 4-(N,N-Dimethylamino)phenyl isothiocyanate; 4-13-00-00173 (Beilstein Handbook Reference); BRN 0388270; NSC 196179; TL 1106; p-(Dimethylamino)phenyl isothiocyanate; p-(N-Dimethylamino)phenyl isothiocyanate; 4-Isothiocyanato-N,N-dimethylaniline; Benzenamine, 4-isothiocyanato-N,N-dimethyl- (9CI) |
| InChI | InChI=1/C9H10N2S/c1-11(2)9-5-3-8(4-6-9)10-7-12/h3-6H,1-2H3 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.2541 |
| Density | 1.04g/cm3 |
| Boiling point | 301°C at 760 mmHg |
| Flash point | 135.8°C |
| Refractive index | 1.56 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
2131-64-8 4-dimethylaminophenyl isothiocyanate
service@apichina.com