| Product Name | 4-Dimethylaminonaphthalene-1-carboxylic acid |
| CAS No. | 78062-03-0 |
| InChI | InChI=1/C13H13NO2/c1-14(2)12-8-7-11(13(15)16)9-5-3-4-6-10(9)12/h3-8H,1-2H3,(H,15,16) |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.2478 |
| Density | 1.236g/cm3 |
| Boiling point | 390°C at 760 mmHg |
| Flash point | 189.7°C |
| Refractive index | 1.674 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
78062-03-0 4-dimethylaminonaphthalene-1-carboxylic acid
service@apichina.com