| Product Name | 4-(dimethylamino)benzylamine dihydrochloride |
| CAS No. | 34403-52-6 |
| Synonyms | 4-(aminomethyl)-N,N-dimethylaniline dihydrochloride; [4-(dimethylamino)phenyl]methanaminium |
| InChI | InChI=1/C9H14N2/c1-11(2)9-5-3-8(7-10)4-6-9/h3-6H,7,10H2,1-2H3/p+1 |
| Molecular Formula | C9H15N2 |
| Molecular Weight | 151.2283 |
| Melting point | 220-224℃ |
| Boiling point | 260°C at 760 mmHg |
| Flash point | 98.6°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
34403-52-6 4-(dimethylamino)benzylamine dihydrochloride
service@apichina.com