| Product Name | 4-(Dimethylamino)benzonitrile |
| CAS No. | 1197-19-9 |
| Synonyms | 4-Dimethylaminobenzonitrile; 4-Cyano-NN-dimethylaniline |
| InChI | InChI=1/C9H10N2/c1-11(2)9-5-3-8(7-10)4-6-9/h3-6H,1-2H3 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.1891 |
| Density | 1.04g/cm3 |
| Melting point | 70-76℃ |
| Boiling point | 318.8°C at 760 mmHg |
| Flash point | 145.4°C |
| Refractive index | 1.55 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
1197-19-9 4-(dimethylamino)benzonitrile
service@apichina.com