| Product Name | 4-Dimethylamino-3,5-dinitrobenzoic acid |
| CAS No. | 82366-55-0 |
| Synonyms | 4-(dimethylamino)-3,5-dinitrobenzoate |
| InChI | InChI=1/C9H9N3O6/c1-10(2)8-6(11(15)16)3-5(9(13)14)4-7(8)12(17)18/h3-4H,1-2H3,(H,13,14)/p-1 |
| Molecular Formula | C9H8N3O6 |
| Molecular Weight | 254.1769 |
| Boiling point | 424.7°C at 760 mmHg |
| Flash point | 210.6°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
82366-55-0 4-dimethylamino-3,5-dinitrobenzoic acid
service@apichina.com