| Product Name | 4-Dimethylamino-2-methylazobenzene |
| CAS No. | 54-88-6 |
| Synonyms | N,N-Dimethyl-4-phenylazo-m-toluidine; N,N,3-trimethyl-4-[(E)-phenyldiazenyl]aniline |
| InChI | InChI=1/C15H17N3/c1-12-11-14(18(2)3)9-10-15(12)17-16-13-7-5-4-6-8-13/h4-11H,1-3H3/b17-16+ |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.3156 |
| Density | 1.01g/cm3 |
| Melting point | 65-68℃ |
| Boiling point | 390.9°C at 760 mmHg |
| Flash point | 190.2°C |
| Refractive index | 1.561 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R23/24:Toxic by inhalation and in contact with skin.; R33:Danger of cummulative effects.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
54-88-6 4-dimethylamino-2-methylazobenzene
service@apichina.com