| Product Name | 4-(dimethylamino)-1,1-dimethoxybut-3-en-2-one |
| CAS No. | 67751-23-9 |
| Synonyms | (3E)-4-(dimethylamino)-1,1-dimethoxybut-3-en-2-one; (3Z)-4-(dimethylamino)-1,1-dimethoxybut-3-en-2-one; 1,1-Dimethoxy-4-dimethylaminobut-3-en-2-one; (Z)-4-(Dimethylamino)-1,1-dimethoxybut-3-en-2-one |
| InChI | InChI=1/C8H15NO3/c1-9(2)6-5-7(10)8(11-3)12-4/h5-6,8H,1-4H3/b6-5- |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.2096 |
| Density | 1.009g/cm3 |
| Boiling point | 211.238°C at 760 mmHg |
| Flash point | 81.554°C |
| Refractive index | 1.453 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
67751-23-9 4-(dimethylamino)-1,1-dimethoxybut-3-en-2-one
service@apichina.com
- Next:127785-66-4 aureobasidin e
- Previous:127785-64-2 basifungin