| Product Name | 4-(difluoromethoxy)nitrobenzene |
| CAS No. | 1544-86-1 |
| Synonyms | 1-(Difluoromethoxy)-4-nitrobenzene; 1-(difluoromethyl)-4-nitrobenzene |
| InChI | InChI=1/C7H5F2NO2/c8-7(9)5-1-3-6(4-2-5)10(11)12/h1-4,7H |
| Molecular Formula | C7H5F2NO2 |
| Molecular Weight | 173.1169 |
| Density | 1.339g/cm3 |
| Melting point | 33-110℃ |
| Boiling point | 240.7°C at 760 mmHg |
| Flash point | 111.9°C |
| Refractive index | 1.5 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1544-86-1 4-(difluoromethoxy)nitrobenzene
service@apichina.com