| Product Name | 4-(difluoromethoxy)benzoic acid |
| CAS No. | 4837-20-1 |
| Synonyms | 4-(difluoromethoxy)benzoate |
| InChI | InChI=1/C8H6F2O3/c9-8(10)13-6-3-1-5(2-4-6)7(11)12/h1-4,8H,(H,11,12)/p-1 |
| Molecular Formula | C8H5F2O3 |
| Molecular Weight | 187.1209 |
| Melting point | 169-171℃ |
| Boiling point | 272.1°C at 760 mmHg |
| Flash point | 118.3°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4837-20-1 4-(difluoromethoxy)benzoic acid
service@apichina.com