| Product Name | 4-(Difluoromethoxy)benzaldehyde |
| CAS No. | 73960-07-3 |
| Synonyms | p-(Difluoromethoxy)benzaldehyde |
| InChI | InChI=1/C8H6F2O2/c9-8(10)12-7-3-1-6(5-11)2-4-7/h1-5,8H |
| Molecular Formula | C8H6F2O2 |
| Molecular Weight | 172.1288 |
| Density | 1.262g/cm3 |
| Boiling point | 234.7°C at 760 mmHg |
| Flash point | 93.1°C |
| Refractive index | 1.497 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
73960-07-3 4-(difluoromethoxy)benzaldehyde
service@apichina.com