| Product Name | 4-Diethylaminophenyl isothiocyanate |
| CAS No. | 84381-54-4 |
| Synonyms | N,N-diethyl-4-isothiocyanatoaniline |
| InChI | InChI=1/C11H14N2S/c1-3-13(4-2)11-7-5-10(6-8-11)12-9-14/h5-8H,3-4H2,1-2H3 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.3073 |
| Density | 1.01g/cm3 |
| Boiling point | 329.9°C at 760 mmHg |
| Flash point | 153.3°C |
| Refractive index | 1.547 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
84381-54-4 4-diethylaminophenyl isothiocyanate
service@apichina.com