| Product Name | 4-Diethylaminobenzonitrile |
| CAS No. | 2873-90-7 |
| Synonyms | 4-(Diethylamino)benzonitrile |
| InChI | InChI=1/C11H14N2/c1-3-13(4-2)11-7-5-10(9-12)6-8-11/h5-8H,3-4H2,1-2H3 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.2423 |
| Density | 1.01g/cm3 |
| Boiling point | 341.8°C at 760 mmHg |
| Flash point | 151.4°C |
| Refractive index | 1.536 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
2873-90-7 4-diethylaminobenzonitrile
service@apichina.com