| Product Name | 4-Cyclohexylresorcinol |
| CAS No. | 2138-20-7 |
| Synonyms | 4-cyclohexylbenzene-1,3-diol |
| InChI | InChI=1/C12H16O2/c13-10-6-7-11(12(14)8-10)9-4-2-1-3-5-9/h6-9,13-14H,1-5H2 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.2542 |
| Density | 1.147g/cm3 |
| Boiling point | 351°C at 760 mmHg |
| Flash point | 170.6°C |
| Refractive index | 1.581 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2138-20-7 4-cyclohexylresorcinol
service@apichina.com