| Product Name | 4-Cyclohexylbenzeneboronic acid |
| CAS No. | 374538-04-2 |
| Synonyms | 4-Cyclohexylphenylboronic acid |
| InChI | InChI=1/C12H17BO2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h6-10,14-15H,1-5H2 |
| Molecular Formula | C12H17BO2 |
| Molecular Weight | 204.0732 |
| Density | 1.09g/cm3 |
| Boiling point | 363.7°C at 760 mmHg |
| Flash point | 173.8°C |
| Refractive index | 1.543 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
374538-04-2 4-cyclohexylbenzeneboronic acid
service@apichina.com