| Product Name | 4-Cyano-5-imidazolecarboxamide |
| CAS No. | 5372-23-6 |
| Synonyms | 4-Cyano-1H-imidazole-5-carboxamide |
| InChI | InChI=1/C5H4N4O/c6-1-3-4(5(7)10)9-2-8-3/h2H,(H2,7,10)(H,8,9) |
| Molecular Formula | C5H4N4O |
| Molecular Weight | 136.1115 |
| Density | 1.51g/cm3 |
| Melting point | 276℃ |
| Boiling point | 572.8°C at 760 mmHg |
| Flash point | 300.2°C |
| Refractive index | 1.617 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
5372-23-6 4-cyano-5-imidazolecarboxamide
service@apichina.com