| Product Name | 4-Cyano-4-phenylpiperidine hydrochloride |
| CAS No. | 51304-58-6 |
| Synonyms | 4-Phenyl-4-piperidinecarbonitrile.HCl; 4-Cyano-4-phenylpiperidine. HCl; 4-phenylpiperidine-4-carbonitrile hydrochloride |
| InChI | InChI=1/C12H14N2/c13-10-12(6-8-14-9-7-12)11-4-2-1-3-5-11/h1-5,14H,6-9H2/p+1 |
| Molecular Formula | C12H15N2 |
| Molecular Weight | 187.2604 |
| Melting point | 210-214℃ |
| Boiling point | 344.6°C at 760 mmHg |
| Flash point | 162.2°C |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
51304-58-6 4-cyano-4-phenylpiperidine hydrochloride
service@apichina.com