| Product Name | 4-cyano-3-(4-methoxyphenyl)-5-(methylthio)thiophene-2-carboxylic acid |
| CAS No. | 116493-07-3 |
| Synonyms | 4-cyano-3-(4-methoxyphenyl)-5-(methylsulfanyl)thiophene-2-carboxylic acid |
| InChI | InChI=1/C14H11NO3S2/c1-18-9-5-3-8(4-6-9)11-10(7-15)14(19-2)20-12(11)13(16)17/h3-6H,1-2H3,(H,16,17) |
| Molecular Formula | C14H11NO3S2 |
| Molecular Weight | 305.372 |
| Density | 1.43g/cm3 |
| Melting point | 209℃ |
| Boiling point | 464.9°C at 760 mmHg |
| Flash point | 234.9°C |
| Refractive index | 1.67 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
116493-07-3 4-cyano-3-(4-methoxyphenyl)-5-(methylthio)thiophene-2-carboxylic acid
service@apichina.com