| Product Name | 4-Chloroquinaldine |
| CAS No. | 4295-06-1 |
| Synonyms | 4-Chloro-2-methylquinoline; 2-Methyl-4-chloroquinoline |
| InChI | InChI=1/C10H8ClN/c1-7-6-9(11)8-4-2-3-5-10(8)12-7/h2-6H,1H3 |
| Molecular Formula | C10H8ClN |
| Molecular Weight | 177.6302 |
| Density | 1.225g/cm3 |
| Melting point | 39-270℃ |
| Boiling point | 269.5°C at 760 mmHg |
| Flash point | 140.2°C |
| Refractive index | 1.634 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4295-06-1 4-chloroquinaldine
service@apichina.com