| Product Name | 4-Chlorophenyl sulfoxide |
| CAS No. | 3085-42-5 |
| Synonyms | Bis(4-chlorophenyl) sulfoxide; 4-Chlorophenyl sulphoxide~4,4-Dichlorodiphenyl sulphoxide; 4,4-Dichlorodiphenyl sulfoxide; 1,1'-sulfinylbis(4-chlorobenzene) |
| InChI | InChI=1/C12H8Cl2OS/c13-9-1-5-11(6-2-9)16(15)12-7-3-10(14)4-8-12/h1-8H |
| Molecular Formula | C12H8Cl2OS |
| Molecular Weight | 271.1623 |
| Density | 1.48g/cm3 |
| Melting point | 140-145℃ |
| Boiling point | 406.2°C at 760 mmHg |
| Flash point | 199.5°C |
| Refractive index | 1.689 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
3085-42-5 4-chlorophenyl sulfoxide
service@apichina.com