| Product Name | 4-Chlorophenyl isothiocyanate |
| CAS No. | 2131-55-7 |
| Synonyms | Isothiocyanic Acid 4-Chlorophenyl Ester; 1-chloro-4-isothiocyanatobenzene; 4-Chloro-phenylisothiocyanate |
| InChI | InChI=1/C7H4ClNS/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
| Molecular Formula | C7H4ClNS |
| Molecular Weight | 169.6314 |
| Density | 1.21g/cm3 |
| Melting point | 43-136℃ |
| Boiling point | 250.2°C at 760 mmHg |
| Flash point | 105.1°C |
| Refractive index | 1.593 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
2131-55-7 4-chlorophenyl isothiocyanate
service@apichina.com