| Product Name | 4-chlorophenyl benzoate |
| CAS No. | 2005-08-5 |
| Synonyms | 4-Chlorophenyl benzoate; benzoic acid 4-chlorophenyl ester |
| InChI | InChI=1/C13H9ClO2/c14-11-6-8-12(9-7-11)16-13(15)10-4-2-1-3-5-10/h1-9H |
| Molecular Formula | C13H9ClO2 |
| Molecular Weight | 232.6624 |
| Density | 1.258g/cm3 |
| Melting point | 87-89℃ |
| Boiling point | 343.1°C at 760 mmHg |
| Flash point | 175.5°C |
| Refractive index | 1.594 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
2005-08-5 4-chlorophenyl benzoate
service@apichina.com