| Product Name | 4-Chlorophenoxyacetyl chloride |
| CAS No. | 4122-68-3 |
| Synonyms | (4-Chlorophenoxy)acetyl chloride; p-chlorophenoxyacetyl chloride |
| InChI | InChI=1/C8H6Cl2O2/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2 |
| Molecular Formula | C8H6Cl2O2 |
| Molecular Weight | 205.038 |
| Density | 1.363g/cm3 |
| Melting point | 18.8℃ |
| Boiling point | 264.5°C at 760 mmHg |
| Flash point | 112.9°C |
| Refractive index | 1.542 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
4122-68-3 4-chlorophenoxyacetyl chloride
service@apichina.com