| Product Name | 4-(chloromethyl)-3-(2,6-dichlorophenyl)-5-methylisoxazole |
| CAS No. | 303225-22-1 |
| InChI | InChI=1/C11H8Cl3NO/c1-6-7(5-12)11(15-16-6)10-8(13)3-2-4-9(10)14/h2-4H,5H2,1H3 |
| Molecular Formula | C11H8Cl3NO |
| Molecular Weight | 276.5463 |
| Density | 1.392g/cm3 |
| Melting point | 61℃ |
| Boiling point | 379.6°C at 760 mmHg |
| Flash point | 183.4°C |
| Refractive index | 1.574 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
303225-22-1 4-(chloromethyl)-3-(2,6-dichlorophenyl)-5-methylisoxazole
service@apichina.com