| Product Name | 4-(chloromethyl)-2-(2-thienyl)-1,3-thiazole |
| CAS No. | 54679-16-2 |
| Synonyms | 4-(chloromethyl)-2-(thiophen-2-yl)-1,3-thiazole |
| InChI | InChI=1/C8H6ClNS2/c9-4-6-5-12-8(10-6)7-2-1-3-11-7/h1-3,5H,4H2 |
| Molecular Formula | C8H6ClNS2 |
| Molecular Weight | 215.7229 |
| Density | 1.395g/cm3 |
| Melting point | 51℃ |
| Boiling point | 362°C at 760 mmHg |
| Flash point | 172.7°C |
| Refractive index | 1.636 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
54679-16-2 4-(chloromethyl)-2-(2-thienyl)-1,3-thiazole
service@apichina.com