| Product Name | 4-(chloromercurio)benzoic acid |
| CAS No. | 59-85-8 |
| Synonyms | 4-chloromercuriobenzoic acid; 4-Chloromercuribenzoic acid; (4-carboxyphenyl)(chloro)mercury; (4-carboxyphenyl)mercury(1+) chloride |
| InChI | InChI=1/C7H5O2.ClH.Hg/c8-7(9)6-4-2-1-3-5-6;;/h2-5H,(H,8,9);1H;/q;;+1/p-1/rC7H5HgO2.ClH/c8-6-3-1-5(2-4-6)7(9)10;/h1-4H,(H,9,10);1H/q+1;/p-1 |
| Molecular Formula | C7H5ClHgO2 |
| Molecular Weight | 357.1564 |
| Melting point | 300℃ |
| Risk Codes | R26/27/28:Very toxic by inhalation, in contact with skin and if swallowed.; R33:Danger of cummulative effects.; |
| Safety | S13:Keep away from food, drink and animal feeding stuffs.; S28:After contact with skin, wash immediately with plenty of ...; S36:Wear suitable protective clothing.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
59-85-8 4-(chloromercurio)benzoic acid
service@apichina.com