| Product Name | 4-chlorobenzanilide |
| CAS No. | 6833-15-4 |
| Synonyms | 4-chloro-N-phenylbenzamide |
| InChI | InChI=1/C13H10ClNO/c14-11-8-6-10(7-9-11)13(16)15-12-4-2-1-3-5-12/h1-9H,(H,15,16) |
| Molecular Formula | C13H10ClNO |
| Molecular Weight | 231.6776 |
| Density | 1.285g/cm3 |
| Melting point | 199-201℃ |
| Boiling point | 288.6°C at 760 mmHg |
| Flash point | 128.3°C |
| Refractive index | 1.649 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
6833-15-4 4-chlorobenzanilide
service@apichina.com