| Product Name | 4-Chloro-o-tolylhydrazine hydrochloride |
| CAS No. | 19690-59-6 |
| Synonyms | 1-(4-Chloro-2-methylphenyl)hydrazine hydrochloride; (4-chloro-2-methylphenyl)hydrazine; (4-chloro-2-methylphenyl)hydrazine hydrochloride |
| InChI | InChI=1/C7H9ClN2.ClH/c1-5-4-6(8)2-3-7(5)10-9;/h2-4,10H,9H2,1H3;1H |
| Molecular Formula | C7H10Cl2N2 |
| Molecular Weight | 193.0737 |
| Melting point | 205-210℃ |
| Boiling point | 254.5°C at 760 mmHg |
| Flash point | 107.7°C |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
19690-59-6 4-chloro-o-tolylhydrazine hydrochloride
service@apichina.com