| Product Name | 4-chloro-7-methylthieno[3,2-d]pyrimidine |
| CAS No. | 175137-21-0 |
| InChI | InChI=1/C7H5ClN2S/c1-4-2-11-6-5(4)9-3-10-7(6)8/h2-3H,1H3 |
| Molecular Formula | C7H5ClN2S |
| Molecular Weight | 184.646 |
| Density | 1.445g/cm3 |
| Melting point | 124℃ |
| Boiling point | 301.3°C at 760 mmHg |
| Flash point | 136°C |
| Refractive index | 1.682 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175137-21-0 4-chloro-7-methylthieno[3,2-d]pyrimidine
service@apichina.com