| Product Name | 4-Chloro-5-nitro-o-phenylenediamine |
| CAS No. | 67073-39-6 |
| Synonyms | 4-chloro-5-nitrobenzene-1,2-diamine |
| InChI | InChI=1/C6H6ClN3O2/c7-3-1-4(8)5(9)2-6(3)10(11)12/h1-2H,8-9H2 |
| Molecular Formula | C6H6ClN3O2 |
| Molecular Weight | 187.5837 |
| Density | 1.592g/cm3 |
| Melting point | 189℃ |
| Boiling point | 458.9°C at 760 mmHg |
| Flash point | 231.3°C |
| Refractive index | 1.712 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
67073-39-6 4-chloro-5-nitro-o-phenylenediamine
service@apichina.com