| Product Name | 4-Chloro-3-nitrocoumarin |
| CAS No. | 38464-20-9 |
| Synonyms | 4-chloro-3-nitro-2H-chromen-2-one |
| InChI | InChI=1/C9H4ClNO4/c10-7-5-3-1-2-4-6(5)15-9(12)8(7)11(13)14/h1-4H |
| Molecular Formula | C9H4ClNO4 |
| Molecular Weight | 225.5854 |
| Density | 1.6g/cm3 |
| Melting point | 160-164℃ |
| Boiling point | 338.7°C at 760 mmHg |
| Flash point | 158.6°C |
| Refractive index | 1.642 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
38464-20-9 4-chloro-3-nitrocoumarin
service@apichina.com