| Product Name | 4-Chloro-3-nitrobenzophenone |
| CAS No. | 56107-02-9 |
| Synonyms | (4-Chloro-3-nitrophenyl)phenylmethanone |
| InChI | InChI=1/C13H8ClNO3/c14-11-7-6-10(8-12(11)15(17)18)13(16)9-4-2-1-3-5-9/h1-8H |
| Molecular Formula | C13H8ClNO3 |
| Molecular Weight | 261.6605 |
| Density | 1.367g/cm3 |
| Melting point | 101-107℃ |
| Boiling point | 386.5°C at 760 mmHg |
| Flash point | 203.4°C |
| Refractive index | 1.623 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21:Harmful by inhalation and in contact with skin.; |
| Safety | S22:Do not inhale dust.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
56107-02-9 4-chloro-3-nitrobenzophenone
service@apichina.com