| Product Name | 4-Chloro-3-nitrobenzamide |
| CAS No. | 16588-06-0 |
| Synonyms | Benzamide, 4-chloro-3-nitro-; 3-Nitro-4-chlorobenzamide; 4-09-00-01227 (Beilstein Handbook Reference); 4-Chlor-3-nitrobenzamid; 4-Chlor-3-nitrobenzamid [Czech]; BRN 0645210; NSC 127825 |
| InChI | InChI=1/C7H5ClN2O3/c8-5-2-1-4(7(9)11)3-6(5)10(12)13/h1-3H,(H2,9,11) |
| Molecular Formula | C7H5ClN2O3 |
| Molecular Weight | 200.5792 |
| Density | 1.52g/cm3 |
| Boiling point | 315.6°C at 760 mmHg |
| Flash point | 144.7°C |
| Refractive index | 1.624 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
16588-06-0 4-chloro-3-nitrobenzamide
service@apichina.com