| Product Name | 4-Chloro-3-nitro-2-pyridone |
| CAS No. | 165547-79-5 |
| Synonyms | 4-Chloro-2-hydroxy-3-nitropyridine; 4-chloro-3-nitropyridin-2(1H)-one; 4-Chloro-3-Nitropyridin-2-Ol |
| InChI | InChI=1/C5H3ClN2O3/c6-3-1-2-7-5(9)4(3)8(10)11/h1-2H,(H,7,9) |
| Molecular Formula | C5H3ClN2O3 |
| Molecular Weight | 174.5419 |
| Density | 1.61g/cm3 |
| Boiling point | 283.4°C at 760 mmHg |
| Flash point | 125.2°C |
| Refractive index | 1.602 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
165547-79-5 4-chloro-3-nitro-2-pyridone
service@apichina.com