| Product Name | 4-Chloro-3-methylbenzoic acid |
| CAS No. | 7697-29-2 |
| Synonyms | 3-Methyl -4-Chlorobenzoic acid; 3-methyl-4-chlorobenzoic acid; 4-CHLORO-M-TOLUIC ACID; 4-Chloro-3-toluic acid; 4-Chloro-3-Methyl |
| InChI | InChI=1/C8H7ClO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,1H3,(H,10,11) |
| Molecular Formula | C8H7ClO2 |
| Molecular Weight | 170.593 |
| Density | 1.31g/cm3 |
| Boiling point | 299°C at 760 mmHg |
| Flash point | 134.6°C |
| Refractive index | 1.573 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
7697-29-2 4-chloro-3-methylbenzoic acid
service@apichina.com