| Product Name | 4-Chloro-3,5-dinitrobenzonitrile |
| CAS No. | 1930-72-9 |
| Synonyms | Benzonitrile, 4-chloro-3,5-dinitro-; 4-Chloro-3,5-dinitrobenzenenitrile; AI3-28718; BRN 1990451; NSC 74453 |
| InChI | InChI=1/C7H2ClN3O4/c8-7-5(10(12)13)1-4(3-9)2-6(7)11(14)15/h1-2H |
| Molecular Formula | C7H2ClN3O4 |
| Molecular Weight | 227.5615 |
| Density | 1.68g/cm3 |
| Melting point | 137-143℃ |
| Boiling point | 326.3°C at 760 mmHg |
| Flash point | 151.2°C |
| Refractive index | 1.631 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
1930-72-9 4-chloro-3,5-dinitrobenzonitrile
service@apichina.com