Sales Email | Service@apichina.com |
CAS No. | 68141-09-3 |
Product Name | 4-chloro-3,5-dimethylphenol, triester with boric acid |
Synonyms | Phenol, 4-chloro-3,5-dimethyl-, 1,1',1''-triester with boric acid (H3BO3); Tris(p-chloro-m-xylenyl)borate; 4-Chloro-3,5-dimethylphenol, triester with boric acid; Phenol, 4-chloro-3,5-dimethyl-, triester with boric acid (H3BO3); tris(4-chloro-3,5-dimethylphenyl) borate |
InChI | InChI=1/C24H24BCl3O3/c1-13-7-19(8-14(2)22(13)26)29-25(30-20-9-15(3)23(27)16(4)10-20)31-21-11-17(5)24(28)18(6)12-21/h7-12H,1-6H3 |
Molecular Formula | C24H24BCl3O3 |
Molecular Weight | 477.6156 |
Density | 1.227g/cm3 |
Boiling point | 522°C at 760 mmHg |
Flash point | 269.5°C |
Refractive index | 1.57 |