| Product Name | 4-chloro-2-phenylquinoline |
| CAS No. | 4979-79-7 |
| Synonyms | quinoline, 4-chloro-2-phenyl-; 4-Chlor-2-phenylchinolin |
| InChI | InChI=1/C15H10ClN/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-10H |
| Molecular Formula | C15H10ClN |
| Molecular Weight | 239.6996 |
| Density | 1.235g/cm3 |
| Boiling point | 378.6°C at 760 mmHg |
| Flash point | 214.6°C |
| Refractive index | 1.66 |
4979-79-7 4-chloro-2-phenylquinoline
service@apichina.com