| Product Name | 4-Chloro-2-phenylquinazoline |
| CAS No. | 6484-25-9 |
| Synonyms | AM-ex-OL |
| InChI | InChI=1/C14H9ClN2/c15-13-11-8-4-5-9-12(11)16-14(17-13)10-6-2-1-3-7-10/h1-9H |
| Molecular Formula | C14H9ClN2 |
| Molecular Weight | 240.6877 |
| Density | 1.285g/cm3 |
| Melting point | 123-128℃ |
| Boiling point | 301.2°C at 760 mmHg |
| Flash point | 164.4°C |
| Refractive index | 1.667 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
6484-25-9 4-chloro-2-phenylquinazoline
service@apichina.com