| Product Name | 4-chloro-2-methylphenyl isocyanate |
| CAS No. | 37408-18-7 |
| Synonyms | 4-Chloro-2-methylphenyl isocyanate; 4-chloro-1-isocyanato-2-methylbenzene |
| InChI | InChI=1/C8H6ClNO/c1-6-4-7(9)2-3-8(6)10-5-11/h2-4H,1H3 |
| Molecular Formula | C8H6ClNO |
| Molecular Weight | 167.5923 |
| Density | 1.17g/cm3 |
| Melting point | 36-40℃ |
| Boiling point | 235.8°C at 760 mmHg |
| Flash point | 86.6°C |
| Refractive index | 1.543 |
| Risk Codes | R26:Very toxic by inhalation.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S22:Do not inhale dust.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S28:After contact with skin, wash immediately with plenty of ...; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
37408-18-7 4-chloro-2-methylphenyl isocyanate
service@apichina.com