| Product Name | 4-Chloro-2-methylisothiocyanatobenzene |
| CAS No. | 23165-53-9 |
| Synonyms | 4-Chloro-2-methylphenyl isothiocyanate; 4-chloro-1-isothiocyanato-2-methylbenzene |
| InChI | InChI=1/C8H6ClNS/c1-6-4-7(9)2-3-8(6)10-5-11/h2-4H,1H3 |
| Molecular Formula | C8H6ClNS |
| Molecular Weight | 183.6579 |
| Density | 1.18g/cm3 |
| Melting point | 33℃ |
| Boiling point | 275.4°C at 760 mmHg |
| Flash point | 120.4°C |
| Refractive index | 1.583 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
23165-53-9 4-chloro-2-methylisothiocyanatobenzene
service@apichina.com