| Product Name | 4-Chloro-2-methylbenzoic acid |
| CAS No. | 7499-07-2 |
| InChI | InChI=1/C8H7ClO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
| Molecular Formula | C8H7ClO2 |
| Molecular Weight | 170.593 |
| Density | 1.31g/cm3 |
| Melting point | 180℃ |
| Boiling point | 300.3°C at 760 mmHg |
| Flash point | 135.4°C |
| Refractive index | 1.573 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
7499-07-2 4-chloro-2-methylbenzoic acid
service@apichina.com