| Product Name | 4-chloro-2-methyl-5-(1-methylhydrazino)-2,3-dihydropyridazin-3-one |
| CAS No. | 96017-23-1 |
| Synonyms | 4-chloro-2-methyl-5-(1-methylhydrazino)pyridazin-3(2H)-one |
| InChI | InChI=1/C6H9ClN4O/c1-10(8)4-3-9-11(2)6(12)5(4)7/h3H,8H2,1-2H3 |
| Molecular Formula | C6H9ClN4O |
| Molecular Weight | 188.6149 |
| Density | 1.46g/cm3 |
| Melting point | 131℃ |
| Boiling point | 251.6°C at 760 mmHg |
| Flash point | 106°C |
| Refractive index | 1.627 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
96017-23-1 4-chloro-2-methyl-5-(1-methylhydrazino)-2,3-dihydropyridazin-3-one
service@apichina.com