| Product Name | 4-Chloro-2-fluoro-6-iodoaniline |
| CAS No. | 216393-67-8 |
| InChI | InChI=1/C6H4ClFIN/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
| Molecular Formula | C6H4ClFIN |
| Molecular Weight | 271.4585 |
| Density | 2.089g/cm3 |
| Boiling point | 267.4°C at 760 mmHg |
| Flash point | 115.5°C |
| Refractive index | 1.665 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
216393-67-8 4-chloro-2-fluoro-6-iodoaniline
service@apichina.com