| Product Name | 4-Chloro-2,3,5,6-tetrafluorobenzoylchloride |
| CAS No. | 145572-10-7 |
| Synonyms | 4-Chloro-2,3,5,6-tetrafluorobenzoyl chloride |
| InChI | InChI=1/C7Cl2F4O/c8-2-5(12)3(10)1(7(9)14)4(11)6(2)13 |
| Molecular Formula | C7Cl2F4O |
| Molecular Weight | 246.9739 |
| Density | 1.707g/cm3 |
| Boiling point | 196.1°C at 760 mmHg |
| Flash point | 72.4°C |
| Refractive index | 1.483 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
145572-10-7 4-chloro-2,3,5,6-tetrafluorobenzoylchloride
service@apichina.com